C10H21O11P3 — CID 54348008
2,3,4-tris[ethoxy(hydroxy)phosphoryl]but-2-enoic acid (PubChem CID 54348008) has the molecular formula C10H21O11P3 and a molecular weight of 410.19 g/mol. Its IUPAC name is 2,3,4-tris[ethoxy(hydroxy)phosphoryl]but-2-enoic acid.
| Compound Name | 2,3,4-tris[ethoxy(hydroxy)phosphoryl]but-2-enoic acid |
|---|---|
| PubChem CID | 54348008 |
| Molecular Formula | C10H21O11P3 |
| Molecular Weight | 410.19 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 2,3,4-tris[ethoxy(hydroxy)phosphoryl]but-2-enoic acid |
| SMILES | CCOP(=O)(O)CC(=C(C(=O)O)P(=O)(O)OCC)P(=O)(O)OCC |
| InChI | InChI=1S/C10H21O11P3/c1-4-19-22(13,14)7-8(23(15,16)20-5-2)9(10(11)12)24(17,18)21-6-3/h4-7H2,1-3H3,(H,11,12)(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | UDRBLTMNDPJVFB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 176.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.19 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|