C9H11F3O3 — CID 54349032
cyclopent-2-en-1-yl 3,3,3-trifluoro-2-methoxypropanoate (PubChem CID 54349032) has the molecular formula C9H11F3O3 and a molecular weight of 224.18 g/mol. Its IUPAC name is cyclopent-2-en-1-yl 3,3,3-trifluoro-2-methoxypropanoate.
| Compound Name | cyclopent-2-en-1-yl 3,3,3-trifluoro-2-methoxypropanoate |
|---|---|
| PubChem CID | 54349032 |
| Molecular Formula | C9H11F3O3 |
| Molecular Weight | 224.18 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | cyclopent-2-en-1-yl 3,3,3-trifluoro-2-methoxypropanoate |
| SMILES | COC(C(=O)OC1C=CCC1)C(F)(F)F |
| InChI | InChI=1S/C9H11F3O3/c1-14-7(9(10,11)12)8(13)15-6-4-2-3-5-6/h2,4,6-7H,3,5H2,1H3 |
| InChIKey | UEJQXSOISQNOBF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.18 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|