C13H10F10O4 — CID 142588393
2-O-[(E)-5,5,6,6,6-pentafluorohex-3-en-2-yl] 1-O-[(E)-4,4,5,5,5-pentafluoropent-2-enyl] oxalate (PubChem CID 142588393) has the molecular formula C13H10F10O4 and a molecular weight of 420.20 g/mol. Its IUPAC name is 2-O-[(E)-5,5,6,6,6-pentafluorohex-3-en-2-yl] 1-O-[(E)-4,4,5,5,5-pentafluoropent-2-enyl] oxalate.
| Compound Name | 2-O-[(E)-5,5,6,6,6-pentafluorohex-3-en-2-yl] 1-O-[(E)-4,4,5,5,5-pentafluoropent-2-enyl] oxalate |
|---|---|
| PubChem CID | 142588393 |
| Molecular Formula | C13H10F10O4 |
| Molecular Weight | 420.20 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | 2-O-[(E)-5,5,6,6,6-pentafluorohex-3-en-2-yl] 1-O-[(E)-4,4,5,5,5-pentafluoropent-2-enyl] oxalate |
| SMILES | CC(/C=C/C(F)(F)C(F)(F)F)OC(=O)C(=O)OC/C=C/C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H10F10O4/c1-7(3-5-11(16,17)13(21,22)23)27-9(25)8(24)26-6-2-4-10(14,15)12(18,19)20/h2-5,7H,6H2,1H3/b4-2+,5-3+ |
| InChIKey | ZXOMYQYLJVCMRN-ZUVMSYQZSA-N |
| XLogP | 3.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.20 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|