C8H10O6 — CID 54352363
(4R,5R)-2-prop-1-en-2-yl-1,3-dioxolane-4,5-dicarboxylic acid (PubChem CID 54352363) has the molecular formula C8H10O6 and a molecular weight of 202.16 g/mol. Its IUPAC name is (4R,5R)-2-prop-1-en-2-yl-1,3-dioxolane-4,5-dicarboxylic acid.
| Compound Name | (4R,5R)-2-prop-1-en-2-yl-1,3-dioxolane-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 54352363 |
| Molecular Formula | C8H10O6 |
| Molecular Weight | 202.16 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | (4R,5R)-2-prop-1-en-2-yl-1,3-dioxolane-4,5-dicarboxylic acid |
| SMILES | C=C(C)C1O[C@@H](C(=O)O)[C@H](C(=O)O)O1 |
| InChI | InChI=1S/C8H10O6/c1-3(2)8-13-4(6(9)10)5(14-8)7(11)12/h4-5,8H,1H2,2H3,(H,9,10)(H,11,12)/t4-,5-/m1/s1 |
| InChIKey | UGRCEHHBYWRMGH-RFZPGFLSSA-N |
| XLogP | -0.16 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.16 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|