C12H13ClN4O3 — CID 54354899
1-(3-chlorophenyl)-3-(4-hydroxy-5-methoxy-1-methylimidazol-2-yl)urea (PubChem CID 54354899) has the molecular formula C12H13ClN4O3 and a molecular weight of 296.71 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(4-hydroxy-5-methoxy-1-methylimidazol-2-yl)urea.
| Compound Name | 1-(3-chlorophenyl)-3-(4-hydroxy-5-methoxy-1-methylimidazol-2-yl)urea |
|---|---|
| PubChem CID | 54354899 |
| Molecular Formula | C12H13ClN4O3 |
| Molecular Weight | 296.71 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(4-hydroxy-5-methoxy-1-methylimidazol-2-yl)urea |
| SMILES | COc1c(O)nc(NC(=O)Nc2cccc(Cl)c2)n1C |
| InChI | InChI=1S/C12H13ClN4O3/c1-17-10(20-2)9(18)15-11(17)16-12(19)14-8-5-3-4-7(13)6-8/h3-6,18H,1-2H3,(H2,14,15,16,19) |
| InChIKey | UIKZHWCXRXZZMJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.71 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |