About 1-prop-2-enoyloxybutyl 6-hydroxy-2-methylidenehexanoate
1-prop-2-enoyloxybutyl 6-hydroxy-2-methylidenehexanoate (PubChem CID 54355105) has the molecular formula C14H22O5
and a molecular weight of 270.32 g/mol. Its IUPAC name is 1-prop-2-enoyloxybutyl 6-hydroxy-2-methylidenehexanoate.
Molecular Properties
| Compound Name | 1-prop-2-enoyloxybutyl 6-hydroxy-2-methylidenehexanoate |
| PubChem CID | 54355105 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 1-prop-2-enoyloxybutyl 6-hydroxy-2-methylidenehexanoate |
| SMILES | C=CC(=O)OC(CCC)OC(=O)C(=C)CCCCO |
| InChI | InChI=1S/C14H22O5/c1-4-8-13(18-12(16)5-2)19-14(17)11(3)9-6-7-10-15/h5,13,15H,2-4,6-10H2,1H3 |
| InChIKey | UIOLHLITMFOBOA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-prop-2-enoyloxybutyl 6-hydroxy-2-methylidenehexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-prop-2-enoyloxybutyl 6-hydroxy-2-methylidenehexanoate?
The IUPAC name of 1-prop-2-enoyloxybutyl 6-hydroxy-2-methylidenehexanoate (CID 54355105) is 1-prop-2-enoyloxybutyl 6-hydroxy-2-methylidenehexanoate.
What is the SMILES notation for 1-prop-2-enoyloxybutyl 6-hydroxy-2-methylidenehexanoate?
The canonical SMILES for 1-prop-2-enoyloxybutyl 6-hydroxy-2-methylidenehexanoate is C=CC(=O)OC(CCC)OC(=O)C(=C)CCCCO.
What is the InChIKey of 1-prop-2-enoyloxybutyl 6-hydroxy-2-methylidenehexanoate?
The InChIKey is UIOLHLITMFOBOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O5/c1-4-8-13(18-12(16)5-2)19-14(17)11(3)9-6-7-10-15/h5,13,15H,2-4,6-10H2,1H3.
What are the key properties of 1-prop-2-enoyloxybutyl 6-hydroxy-2-methylidenehexanoate?
1-prop-2-enoyloxybutyl 6-hydroxy-2-methylidenehexanoate has a molecular weight of 270.32 g/mol, XLogP of 2.10, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-prop-2-enoyloxybutyl 6-hydroxy-2-methylidenehexanoate is sourced from PubChem (CID 54355105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).