C13H15NO5 — CID 54355225
(2R,3R,4R)-2-(hydroxymethyl)-5-(1H-indol-5-yloxy)oxolane-3,4-diol (PubChem CID 54355225) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is (2R,3R,4R)-2-(hydroxymethyl)-5-(1H-indol-5-yloxy)oxolane-3,4-diol.
| Compound Name | (2R,3R,4R)-2-(hydroxymethyl)-5-(1H-indol-5-yloxy)oxolane-3,4-diol |
|---|---|
| PubChem CID | 54355225 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | (2R,3R,4R)-2-(hydroxymethyl)-5-(1H-indol-5-yloxy)oxolane-3,4-diol |
| SMILES | OC[C@H]1OC(Oc2ccc3[nH]ccc3c2)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H15NO5/c15-6-10-11(16)12(17)13(19-10)18-8-1-2-9-7(5-8)3-4-14-9/h1-5,10-17H,6H2/t10-,11+,12-,13?/m1/s1 |
| InChIKey | UIQLPLCXMOSWNM-DAAZQVBGSA-N |
| XLogP | -0.01 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |