C9H14F3NO3 — CID 54355926
tert-butyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]propanoate (PubChem CID 54355926) has the molecular formula C9H14F3NO3 and a molecular weight of 241.21 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]propanoate.
| Compound Name | tert-butyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
|---|---|
| PubChem CID | 54355926 |
| Molecular Formula | C9H14F3NO3 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | tert-butyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
| SMILES | C[C@H](NC(=O)C(F)(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H14F3NO3/c1-5(6(14)16-8(2,3)4)13-7(15)9(10,11)12/h5H,1-4H3,(H,13,15)/t5-/m0/s1 |
| InChIKey | UJBZOOJJICILBW-YFKPBYRVSA-N |
| XLogP | 1.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |