C28H24F2N2O2 — CID 54356515
methyl 2-[2-(4-fluorophenyl)ethyl]-5-[2-(4-fluorophenyl)-3-imidazol-1-ylprop-1-enyl]benzoate (PubChem CID 54356515) has the molecular formula C28H24F2N2O2 and a molecular weight of 458.51 g/mol. Its IUPAC name is methyl 2-[2-(4-fluorophenyl)ethyl]-5-[2-(4-fluorophenyl)-3-imidazol-1-ylprop-1-enyl]benzoate.
| Compound Name | methyl 2-[2-(4-fluorophenyl)ethyl]-5-[2-(4-fluorophenyl)-3-imidazol-1-ylprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 54356515 |
| Molecular Formula | C28H24F2N2O2 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | methyl 2-[2-(4-fluorophenyl)ethyl]-5-[2-(4-fluorophenyl)-3-imidazol-1-ylprop-1-enyl]benzoate |
| SMILES | COC(=O)c1cc(C=C(Cn2ccnc2)c2ccc(F)cc2)ccc1CCc1ccc(F)cc1 |
| InChI | InChI=1S/C28H24F2N2O2/c1-34-28(33)27-17-21(3-7-23(27)6-2-20-4-10-25(29)11-5-20)16-24(18-32-15-14-31-19-32)22-8-12-26(30)13-9-22/h3-5,7-17,19H,2,6,18H2,1H3 |
| InChIKey | UJMDTONVFGNDSZ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|