C10H9NO2 — CID 54357465
4-(2-cyanoethenyl)hepta-2,4,6-trienoic acid (PubChem CID 54357465) has the molecular formula C10H9NO2 and a molecular weight of 175.19 g/mol. Its IUPAC name is 4-(2-cyanoethenyl)hepta-2,4,6-trienoic acid.
| Compound Name | 4-(2-cyanoethenyl)hepta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 54357465 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 4-(2-cyanoethenyl)hepta-2,4,6-trienoic acid |
| SMILES | C=CC=C(C=CC#N)C=CC(=O)O |
| InChI | InChI=1S/C10H9NO2/c1-2-4-9(5-3-8-11)6-7-10(12)13/h2-7H,1H2,(H,12,13) |
| InChIKey | UKCNXODIBIZOQW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|