C10H21NO6 — CID 54357604
(3R,4S,5S,6R)-2-(3-aminobutoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 54357604) has the molecular formula C10H21NO6 and a molecular weight of 251.28 g/mol. Its IUPAC name is (3R,4S,5S,6R)-2-(3-aminobutoxy)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (3R,4S,5S,6R)-2-(3-aminobutoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 54357604 |
| Molecular Formula | C10H21NO6 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | (3R,4S,5S,6R)-2-(3-aminobutoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC(N)CCOC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H21NO6/c1-5(11)2-3-16-10-9(15)8(14)7(13)6(4-12)17-10/h5-10,12-15H,2-4,11H2,1H3/t5?,6-,7-,8+,9-,10?/m1/s1 |
| InChIKey | UKFFYEPELKZVJR-VXIHOVOASA-N |
| XLogP | -2.46 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |