C5H6N2O2S — CID 54358869
5-methyl-1-sulfanylpyrimidine-2,4-dione (PubChem CID 54358869) has the molecular formula C5H6N2O2S and a molecular weight of 158.18 g/mol. Its IUPAC name is 5-methyl-1-sulfanylpyrimidine-2,4-dione.
| Compound Name | 5-methyl-1-sulfanylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 54358869 |
| Molecular Formula | C5H6N2O2S |
| Molecular Weight | 158.18 g/mol |
| Exact Mass | 158.01 |
| IUPAC Name | 5-methyl-1-sulfanylpyrimidine-2,4-dione |
| SMILES | Cc1cn(S)c(=O)[nH]c1=O |
| InChI | InChI=1S/C5H6N2O2S/c1-3-2-7(10)5(9)6-4(3)8/h2,10H,1H3,(H,6,8,9) |
| InChIKey | ULBDBPZJCAAYHR-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.18 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|