C14H23NO2 — CID 54359974
2-hexyl-4,5,6,7-tetrahydroisoindole-1,3-diol (PubChem CID 54359974) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is 2-hexyl-4,5,6,7-tetrahydroisoindole-1,3-diol.
| Compound Name | 2-hexyl-4,5,6,7-tetrahydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 54359974 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 2-hexyl-4,5,6,7-tetrahydroisoindole-1,3-diol |
| SMILES | CCCCCCn1c(O)c2c(c1O)CCCC2 |
| InChI | InChI=1S/C14H23NO2/c1-2-3-4-7-10-15-13(16)11-8-5-6-9-12(11)14(15)17/h16-17H,2-10H2,1H3 |
| InChIKey | AXGXXGCDWPSGLA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|