C23H44NO2+ — CID 54362597
(1-hydroxy-3-oxoicosa-11,14-dien-2-yl)-trimethylazanium (PubChem CID 54362597) has the molecular formula C23H44NO2+ and a molecular weight of 366.61 g/mol. Its IUPAC name is (1-hydroxy-3-oxoicosa-11,14-dien-2-yl)-trimethylazanium.
| Compound Name | (1-hydroxy-3-oxoicosa-11,14-dien-2-yl)-trimethylazanium |
|---|---|
| PubChem CID | 54362597 |
| Molecular Formula | C23H44NO2+ |
| Molecular Weight | 366.61 g/mol |
| Exact Mass | 366.34 |
| IUPAC Name | (1-hydroxy-3-oxoicosa-11,14-dien-2-yl)-trimethylazanium |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)C(CO)[N+](C)(C)C |
| InChI | InChI=1S/C23H44NO2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23(26)22(21-25)24(2,3)4/h9-10,12-13,22,25H,5-8,11,14-21H2,1-4H3/q+1 |
| InChIKey | UNNUOWRXMGJASV-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.61 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|