C15H25N3O3 — CID 54362876
[(3R)-1-[4-(dimethylamino)but-2-ynyl]-2-oxopyrrolidin-3-yl] N-butylcarbamate (PubChem CID 54362876) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is [(3R)-1-[4-(dimethylamino)but-2-ynyl]-2-oxopyrrolidin-3-yl] N-butylcarbamate.
| Compound Name | [(3R)-1-[4-(dimethylamino)but-2-ynyl]-2-oxopyrrolidin-3-yl] N-butylcarbamate |
|---|---|
| PubChem CID | 54362876 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | [(3R)-1-[4-(dimethylamino)but-2-ynyl]-2-oxopyrrolidin-3-yl] N-butylcarbamate |
| SMILES | CCCCNC(=O)O[C@@H]1CCN(CC#CCN(C)C)C1=O |
| InChI | InChI=1S/C15H25N3O3/c1-4-5-9-16-15(20)21-13-8-12-18(14(13)19)11-7-6-10-17(2)3/h13H,4-5,8-12H2,1-3H3,(H,16,20)/t13-/m1/s1 |
| InChIKey | UNSXOAYJHISYOO-CYBMUJFWSA-N |
| XLogP | 0.68 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|