C13H14INO3 — CID 54364917
ethyl 7-amino-9-iodo-2,3-dihydro-1-benzoxepine-4-carboxylate (PubChem CID 54364917) has the molecular formula C13H14INO3 and a molecular weight of 359.16 g/mol. Its IUPAC name is ethyl 7-amino-9-iodo-2,3-dihydro-1-benzoxepine-4-carboxylate.
| Compound Name | ethyl 7-amino-9-iodo-2,3-dihydro-1-benzoxepine-4-carboxylate |
|---|---|
| PubChem CID | 54364917 |
| Molecular Formula | C13H14INO3 |
| Molecular Weight | 359.16 g/mol |
| Exact Mass | 359.00 |
| IUPAC Name | ethyl 7-amino-9-iodo-2,3-dihydro-1-benzoxepine-4-carboxylate |
| SMILES | CCOC(=O)C1=Cc2cc(N)cc(I)c2OCC1 |
| InChI | InChI=1S/C13H14INO3/c1-2-17-13(16)8-3-4-18-12-9(5-8)6-10(15)7-11(12)14/h5-7H,2-4,15H2,1H3 |
| InChIKey | UPCTVSMXTHTSOW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.16 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|