C14H26O3 — CID 54365598
4-cyclohexyl-2,2,4-trimethylpentaneperoxoic acid (PubChem CID 54365598) has the molecular formula C14H26O3 and a molecular weight of 242.36 g/mol. Its IUPAC name is 4-cyclohexyl-2,2,4-trimethylpentaneperoxoic acid.
| Compound Name | 4-cyclohexyl-2,2,4-trimethylpentaneperoxoic acid |
|---|---|
| PubChem CID | 54365598 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 4-cyclohexyl-2,2,4-trimethylpentaneperoxoic acid |
| SMILES | CC(C)(CC(C)(C)C1CCCCC1)C(=O)OO |
| InChI | InChI=1S/C14H26O3/c1-13(2,11-8-6-5-7-9-11)10-14(3,4)12(15)17-16/h11,16H,5-10H2,1-4H3 |
| InChIKey | UPNZKEGXSNQEPW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|