C19H24N4O3 — CID 54368816
methyl 2-[4-[4-(4-cyanophenyl)-3-oxopiperazin-1-yl]piperidin-1-yl]acetate (PubChem CID 54368816) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is methyl 2-[4-[4-(4-cyanophenyl)-3-oxopiperazin-1-yl]piperidin-1-yl]acetate.
| Compound Name | methyl 2-[4-[4-(4-cyanophenyl)-3-oxopiperazin-1-yl]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 54368816 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | methyl 2-[4-[4-(4-cyanophenyl)-3-oxopiperazin-1-yl]piperidin-1-yl]acetate |
| SMILES | COC(=O)CN1CCC(N2CCN(c3ccc(C#N)cc3)C(=O)C2)CC1 |
| InChI | InChI=1S/C19H24N4O3/c1-26-19(25)14-21-8-6-16(7-9-21)22-10-11-23(18(24)13-22)17-4-2-15(12-20)3-5-17/h2-5,16H,6-11,13-14H2,1H3 |
| InChIKey | URRUIZYGEQAKLX-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 76.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |