C18H17N5O2 — CID 70706711
4-[4-(2-ethylpyrimidine-5-carbonyl)-2-oxopiperazin-1-yl]benzonitrile (PubChem CID 70706711) has the molecular formula C18H17N5O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is 4-[4-(2-ethylpyrimidine-5-carbonyl)-2-oxopiperazin-1-yl]benzonitrile.
| Compound Name | 4-[4-(2-ethylpyrimidine-5-carbonyl)-2-oxopiperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 70706711 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 4-[4-(2-ethylpyrimidine-5-carbonyl)-2-oxopiperazin-1-yl]benzonitrile |
| SMILES | CCc1ncc(C(=O)N2CCN(c3ccc(C#N)cc3)C(=O)C2)cn1 |
| InChI | InChI=1S/C18H17N5O2/c1-2-16-20-10-14(11-21-16)18(25)22-7-8-23(17(24)12-22)15-5-3-13(9-19)4-6-15/h3-6,10-11H,2,7-8,12H2,1H3 |
| InChIKey | BGUDQTXBAITQKI-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 90.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |