C19H15N7O3 — CID 70753051
4-[4-[2-hydroxy-5-(tetrazol-1-yl)benzoyl]-2-oxopiperazin-1-yl]benzonitrile (PubChem CID 70753051) has the molecular formula C19H15N7O3 and a molecular weight of 389.38 g/mol. Its IUPAC name is 4-[4-[2-hydroxy-5-(tetrazol-1-yl)benzoyl]-2-oxopiperazin-1-yl]benzonitrile.
| Compound Name | 4-[4-[2-hydroxy-5-(tetrazol-1-yl)benzoyl]-2-oxopiperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 70753051 |
| Molecular Formula | C19H15N7O3 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 4-[4-[2-hydroxy-5-(tetrazol-1-yl)benzoyl]-2-oxopiperazin-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2CCN(C(=O)c3cc(-n4cnnn4)ccc3O)CC2=O)cc1 |
| InChI | InChI=1S/C19H15N7O3/c20-10-13-1-3-14(4-2-13)25-8-7-24(11-18(25)28)19(29)16-9-15(5-6-17(16)27)26-12-21-22-23-26/h1-6,9,12,27H,7-8,11H2 |
| InChIKey | PFOIOEYSYNXHBY-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 128.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |