C15H23NO2 — CID 54374840
3-[dimethylamino-[(1R,2R)-2-hydroxycyclohexyl]methyl]phenol (PubChem CID 54374840) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 3-[dimethylamino-[(1R,2R)-2-hydroxycyclohexyl]methyl]phenol.
| Compound Name | 3-[dimethylamino-[(1R,2R)-2-hydroxycyclohexyl]methyl]phenol |
|---|---|
| PubChem CID | 54374840 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 3-[dimethylamino-[(1R,2R)-2-hydroxycyclohexyl]methyl]phenol |
| SMILES | CN(C)C(c1cccc(O)c1)[C@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C15H23NO2/c1-16(2)15(11-6-5-7-12(17)10-11)13-8-3-4-9-14(13)18/h5-7,10,13-15,17-18H,3-4,8-9H2,1-2H3/t13-,14+,15?/m0/s1 |
| InChIKey | UVTLONZTPXCUPU-SNTRVMSOSA-N |
| XLogP | 2.55 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |