C10H18 — CID 54375477
(3S,4S)-4-methyl-3-propan-2-ylcyclohexene (PubChem CID 54375477) has the molecular formula C10H18 and a molecular weight of 138.25 g/mol. Its IUPAC name is (3S,4S)-4-methyl-3-propan-2-ylcyclohexene.
| Compound Name | (3S,4S)-4-methyl-3-propan-2-ylcyclohexene |
|---|---|
| PubChem CID | 54375477 |
| Molecular Formula | C10H18 |
| Molecular Weight | 138.25 g/mol |
| Exact Mass | 138.14 |
| IUPAC Name | (3S,4S)-4-methyl-3-propan-2-ylcyclohexene |
| SMILES | CC(C)[C@@H]1C=CCC[C@@H]1C |
| InChI | InChI=1S/C10H18/c1-8(2)10-7-5-4-6-9(10)3/h5,7-10H,4,6H2,1-3H3/t9-,10-/m0/s1 |
| InChIKey | UWESFCGDVGYVIZ-UWVGGRQHSA-N |
| XLogP | 3.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.25 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|