About tetradecyl 2-formyloxyacetate
tetradecyl 2-formyloxyacetate (PubChem CID 54376486) has the molecular formula C17H32O4
and a molecular weight of 300.44 g/mol. Its IUPAC name is tetradecyl 2-formyloxyacetate.
Molecular Properties
| Compound Name | tetradecyl 2-formyloxyacetate |
| PubChem CID | 54376486 |
| Molecular Formula | C17H32O4 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | tetradecyl 2-formyloxyacetate |
| SMILES | CCCCCCCCCCCCCCOC(=O)COC=O |
| InChI | InChI=1S/C17H32O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-21-17(19)15-20-16-18/h16H,2-15H2,1H3 |
| InChIKey | CUUGEDUWJZAHMH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tetradecyl 2-formyloxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetradecyl 2-formyloxyacetate?
The IUPAC name of tetradecyl 2-formyloxyacetate (CID 54376486) is tetradecyl 2-formyloxyacetate.
What is the SMILES notation for tetradecyl 2-formyloxyacetate?
The canonical SMILES for tetradecyl 2-formyloxyacetate is CCCCCCCCCCCCCCOC(=O)COC=O.
What is the InChIKey of tetradecyl 2-formyloxyacetate?
The InChIKey is CUUGEDUWJZAHMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-21-17(19)15-20-16-18/h16H,2-15H2,1H3.
What are the key properties of tetradecyl 2-formyloxyacetate?
tetradecyl 2-formyloxyacetate has a molecular weight of 300.44 g/mol, XLogP of 4.40, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tetradecyl 2-formyloxyacetate is sourced from PubChem (CID 54376486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).