C31H30N4O2 — CID 54376553
2-[4-[3-(8-nitronaphthalen-1-yl)prop-2-enyl]piperazin-1-yl]-7-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene (PubChem CID 54376553) has the molecular formula C31H30N4O2 and a molecular weight of 490.61 g/mol. Its IUPAC name is 2-[4-[3-(8-nitronaphthalen-1-yl)prop-2-enyl]piperazin-1-yl]-7-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene.
| Compound Name | 2-[4-[3-(8-nitronaphthalen-1-yl)prop-2-enyl]piperazin-1-yl]-7-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene |
|---|---|
| PubChem CID | 54376553 |
| Molecular Formula | C31H30N4O2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 2-[4-[3-(8-nitronaphthalen-1-yl)prop-2-enyl]piperazin-1-yl]-7-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene |
| SMILES | O=[N+]([O-])c1cccc2cccc(C=CCN3CCN(C4c5ccccc5CCc5ncccc54)CC3)c12 |
| InChI | InChI=1S/C31H30N4O2/c36-35(37)29-14-4-10-24-8-3-9-25(30(24)29)11-6-18-33-19-21-34(22-20-33)31-26-12-2-1-7-23(26)15-16-28-27(31)13-5-17-32-28/h1-14,17,31H,15-16,18-22H2 |
| InChIKey | UWXIGZDWCGUPLM-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 62.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|