C18H24N4O3 — CID 91943814
1-[1-[3-(2-nitrophenyl)prop-2-enyl]piperidin-4-yl]-1,3-diazinan-2-one (PubChem CID 91943814) has the molecular formula C18H24N4O3 and a molecular weight of 344.41 g/mol. Its IUPAC name is 1-[1-[3-(2-nitrophenyl)prop-2-enyl]piperidin-4-yl]-1,3-diazinan-2-one.
| Compound Name | 1-[1-[3-(2-nitrophenyl)prop-2-enyl]piperidin-4-yl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 91943814 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 1-[1-[3-(2-nitrophenyl)prop-2-enyl]piperidin-4-yl]-1,3-diazinan-2-one |
| SMILES | O=C1NCCCN1C1CCN(CC=Cc2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C18H24N4O3/c23-18-19-10-4-12-21(18)16-8-13-20(14-9-16)11-3-6-15-5-1-2-7-17(15)22(24)25/h1-3,5-7,16H,4,8-14H2,(H,19,23) |
| InChIKey | JGVWXODVZRZPOK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|