C16H22N2O2 — CID 757332
(2S)-2-ethyl-1-[(E)-3-(2-nitrophenyl)prop-2-enyl]piperidine (PubChem CID 757332) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is (2S)-2-ethyl-1-[(E)-3-(2-nitrophenyl)prop-2-enyl]piperidine.
| Compound Name | (2S)-2-ethyl-1-[(E)-3-(2-nitrophenyl)prop-2-enyl]piperidine |
|---|---|
| PubChem CID | 757332 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | (2S)-2-ethyl-1-[(E)-3-(2-nitrophenyl)prop-2-enyl]piperidine |
| SMILES | CC[C@H]1CCCCN1C/C=C/c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H22N2O2/c1-2-15-10-5-6-12-17(15)13-7-9-14-8-3-4-11-16(14)18(19)20/h3-4,7-9,11,15H,2,5-6,10,12-13H2,1H3/b9-7+/t15-/m0/s1 |
| InChIKey | POPOFVNWGIWNGF-HEWZJLJBSA-N |
| XLogP | 3.87 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|