C12H16O4S — CID 54378257
3-(3-hydroxypent-4-enyl)-4-methylbenzenesulfonic acid (PubChem CID 54378257) has the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. Its IUPAC name is 3-(3-hydroxypent-4-enyl)-4-methylbenzenesulfonic acid.
| Compound Name | 3-(3-hydroxypent-4-enyl)-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 54378257 |
| Molecular Formula | C12H16O4S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 3-(3-hydroxypent-4-enyl)-4-methylbenzenesulfonic acid |
| SMILES | C=CC(O)CCc1cc(S(=O)(=O)O)ccc1C |
| InChI | InChI=1S/C12H16O4S/c1-3-11(13)6-5-10-8-12(17(14,15)16)7-4-9(10)2/h3-4,7-8,11,13H,1,5-6H2,2H3,(H,14,15,16) |
| InChIKey | UYCHUSDSBHRKNU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|