C11H14N2OS2 — CID 54378376
N'-(1-phenoxypropan-2-yl)ethanedithioamide (PubChem CID 54378376) has the molecular formula C11H14N2OS2 and a molecular weight of 254.38 g/mol. Its IUPAC name is N'-(1-phenoxypropan-2-yl)ethanedithioamide.
| Compound Name | N'-(1-phenoxypropan-2-yl)ethanedithioamide |
|---|---|
| PubChem CID | 54378376 |
| Molecular Formula | C11H14N2OS2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | N'-(1-phenoxypropan-2-yl)ethanedithioamide |
| SMILES | CC(COc1ccccc1)NC(=S)C(N)=S |
| InChI | InChI=1S/C11H14N2OS2/c1-8(13-11(16)10(12)15)7-14-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H2,12,15)(H,13,16) |
| InChIKey | UYEIRUKIYGVTPY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|