C21H31FO — CID 54382352
2-fluoro-4-[2-(4-prop-1-enylcyclohexyl)ethyl]-1-(propoxymethyl)benzene (PubChem CID 54382352) has the molecular formula C21H31FO and a molecular weight of 318.48 g/mol. Its IUPAC name is 2-fluoro-4-[2-(4-prop-1-enylcyclohexyl)ethyl]-1-(propoxymethyl)benzene.
| Compound Name | 2-fluoro-4-[2-(4-prop-1-enylcyclohexyl)ethyl]-1-(propoxymethyl)benzene |
|---|---|
| PubChem CID | 54382352 |
| Molecular Formula | C21H31FO |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | 2-fluoro-4-[2-(4-prop-1-enylcyclohexyl)ethyl]-1-(propoxymethyl)benzene |
| SMILES | CC=CC1CCC(CCc2ccc(COCCC)c(F)c2)CC1 |
| InChI | InChI=1S/C21H31FO/c1-3-5-17-6-8-18(9-7-17)10-11-19-12-13-20(21(22)15-19)16-23-14-4-2/h3,5,12-13,15,17-18H,4,6-11,14,16H2,1-2H3 |
| InChIKey | VAUPGCJPTVUXEI-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|