C19H22N2O6S — CID 54386396
tert-butyl (6S)-3,5,8-trioxo-7-[(2-phenylacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate (PubChem CID 54386396) has the molecular formula C19H22N2O6S and a molecular weight of 406.46 g/mol. Its IUPAC name is tert-butyl (6S)-3,5,8-trioxo-7-[(2-phenylacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate.
| Compound Name | tert-butyl (6S)-3,5,8-trioxo-7-[(2-phenylacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
|---|---|
| PubChem CID | 54386396 |
| Molecular Formula | C19H22N2O6S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | tert-butyl (6S)-3,5,8-trioxo-7-[(2-phenylacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1C(=O)CS(=O)[C@H]2C(NC(=O)Cc3ccccc3)C(=O)N12 |
| InChI | InChI=1S/C19H22N2O6S/c1-19(2,3)27-18(25)15-12(22)10-28(26)17-14(16(24)21(15)17)20-13(23)9-11-7-5-4-6-8-11/h4-8,14-15,17H,9-10H2,1-3H3,(H,20,23)/t14?,15?,17-,28?/m0/s1 |
| InChIKey | VDNRQTSGVIEWKI-NHVLQIAESA-N |
| XLogP | -0.08 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|