C15H14N2O7S — CID 67616456
(2R,5R,6R,7R)-3,5,8-trioxo-7-[(2-phenoxyacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylic acid (PubChem CID 67616456) has the molecular formula C15H14N2O7S and a molecular weight of 366.35 g/mol. Its IUPAC name is (2R,5R,6R,7R)-3,5,8-trioxo-7-[(2-phenoxyacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylic acid.
| Compound Name | (2R,5R,6R,7R)-3,5,8-trioxo-7-[(2-phenoxyacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 67616456 |
| Molecular Formula | C15H14N2O7S |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | (2R,5R,6R,7R)-3,5,8-trioxo-7-[(2-phenoxyacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylic acid |
| SMILES | O=C(COc1ccccc1)N[C@@H]1C(=O)N2[C@@H](C(=O)O)C(=O)C[S@@](=O)[C@H]12 |
| InChI | InChI=1S/C15H14N2O7S/c18-9-7-25(23)14-11(13(20)17(14)12(9)15(21)22)16-10(19)6-24-8-4-2-1-3-5-8/h1-5,11-12,14H,6-7H2,(H,16,19)(H,21,22)/t11-,12-,14-,25-/m1/s1 |
| InChIKey | OMVQKCURMORTFV-JJHBICMOSA-N |
| XLogP | -1.50 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|