C25H39NO5Si — CID 54387821
benzyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(5-ethoxy-5-oxopent-3-enyl)pyrrolidine-1-carboxylate (PubChem CID 54387821) has the molecular formula C25H39NO5Si and a molecular weight of 461.68 g/mol. Its IUPAC name is benzyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(5-ethoxy-5-oxopent-3-enyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(5-ethoxy-5-oxopent-3-enyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 54387821 |
| Molecular Formula | C25H39NO5Si |
| Molecular Weight | 461.68 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | benzyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(5-ethoxy-5-oxopent-3-enyl)pyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)C=CCC[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H39NO5Si/c1-7-29-23(27)16-12-11-15-21-22(31-32(5,6)25(2,3)4)17-18-26(21)24(28)30-19-20-13-9-8-10-14-20/h8-10,12-14,16,21-22H,7,11,15,17-19H2,1-6H3/t21-,22+/m1/s1 |
| InChIKey | VEMWOWICLREPMI-YADHBBJMSA-N |
| XLogP | 5.69 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.68 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|