C11H10NO5S2- — CID 54388084
1-[methyl(sulfinato)amino]-6-sulfonaphthalene (PubChem CID 54388084) has the molecular formula C11H10NO5S2- and a molecular weight of 300.34 g/mol. Its IUPAC name is 1-[methyl(sulfinato)amino]-6-sulfonaphthalene.
| Compound Name | 1-[methyl(sulfinato)amino]-6-sulfonaphthalene |
|---|---|
| PubChem CID | 54388084 |
| Molecular Formula | C11H10NO5S2- |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 1-[methyl(sulfinato)amino]-6-sulfonaphthalene |
| SMILES | CN(c1cccc2cc(S(=O)(=O)O)ccc12)S(=O)[O-] |
| InChI | InChI=1S/C11H11NO5S2/c1-12(18(13)14)11-4-2-3-8-7-9(19(15,16)17)5-6-10(8)11/h2-7H,1H3,(H,13,14)(H,15,16,17)/p-1 |
| InChIKey | FKRLRWFMIBHUFO-UHFFFAOYSA-M |
| XLogP | 1.32 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|