C20H23F2NO — CID 54389174
3-[4-(2,4-difluorophenoxy)phenyl]-N,N-diethylbut-2-en-1-amine (PubChem CID 54389174) has the molecular formula C20H23F2NO and a molecular weight of 331.41 g/mol. Its IUPAC name is 3-[4-(2,4-difluorophenoxy)phenyl]-N,N-diethylbut-2-en-1-amine.
| Compound Name | 3-[4-(2,4-difluorophenoxy)phenyl]-N,N-diethylbut-2-en-1-amine |
|---|---|
| PubChem CID | 54389174 |
| Molecular Formula | C20H23F2NO |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 3-[4-(2,4-difluorophenoxy)phenyl]-N,N-diethylbut-2-en-1-amine |
| SMILES | CCN(CC)CC=C(C)c1ccc(Oc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C20H23F2NO/c1-4-23(5-2)13-12-15(3)16-6-9-18(10-7-16)24-20-11-8-17(21)14-19(20)22/h6-12,14H,4-5,13H2,1-3H3 |
| InChIKey | VFKJJPWEDVJHQE-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |