C19H22F3N2O6P — CID 54390541
N-(diethoxyphosphorylmethyl)-2-nitro-5-phenylmethoxy-4-(trifluoromethyl)aniline (PubChem CID 54390541) has the molecular formula C19H22F3N2O6P and a molecular weight of 462.36 g/mol. Its IUPAC name is N-(diethoxyphosphorylmethyl)-2-nitro-5-phenylmethoxy-4-(trifluoromethyl)aniline.
| Compound Name | N-(diethoxyphosphorylmethyl)-2-nitro-5-phenylmethoxy-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 54390541 |
| Molecular Formula | C19H22F3N2O6P |
| Molecular Weight | 462.36 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | N-(diethoxyphosphorylmethyl)-2-nitro-5-phenylmethoxy-4-(trifluoromethyl)aniline |
| SMILES | CCOP(=O)(CNc1cc(OCc2ccccc2)c(C(F)(F)F)cc1[N+](=O)[O-])OCC |
| InChI | InChI=1S/C19H22F3N2O6P/c1-3-29-31(27,30-4-2)13-23-16-11-18(28-12-14-8-6-5-7-9-14)15(19(20,21)22)10-17(16)24(25)26/h5-11,23H,3-4,12-13H2,1-2H3 |
| InChIKey | VGIBFDXFBFTMGZ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.36 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|