C18H26F3N2O8P — CID 54265902
butyl 2-[5-(diethoxyphosphorylmethylamino)-4-nitro-2-(trifluoromethyl)phenoxy]acetate (PubChem CID 54265902) has the molecular formula C18H26F3N2O8P and a molecular weight of 486.38 g/mol. Its IUPAC name is butyl 2-[5-(diethoxyphosphorylmethylamino)-4-nitro-2-(trifluoromethyl)phenoxy]acetate.
| Compound Name | butyl 2-[5-(diethoxyphosphorylmethylamino)-4-nitro-2-(trifluoromethyl)phenoxy]acetate |
|---|---|
| PubChem CID | 54265902 |
| Molecular Formula | C18H26F3N2O8P |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | butyl 2-[5-(diethoxyphosphorylmethylamino)-4-nitro-2-(trifluoromethyl)phenoxy]acetate |
| SMILES | CCCCOC(=O)COc1cc(NCP(=O)(OCC)OCC)c([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C18H26F3N2O8P/c1-4-7-8-28-17(24)11-29-16-10-14(22-12-32(27,30-5-2)31-6-3)15(23(25)26)9-13(16)18(19,20)21/h9-10,22H,4-8,11-12H2,1-3H3 |
| InChIKey | RGSZREIVKCSCAP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|