C16H21F3N2O4 — CID 60586269
N-heptan-2-yl-2-[4-nitro-2-(trifluoromethyl)phenoxy]acetamide (PubChem CID 60586269) has the molecular formula C16H21F3N2O4 and a molecular weight of 362.35 g/mol. Its IUPAC name is N-heptan-2-yl-2-[4-nitro-2-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-heptan-2-yl-2-[4-nitro-2-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 60586269 |
| Molecular Formula | C16H21F3N2O4 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | N-heptan-2-yl-2-[4-nitro-2-(trifluoromethyl)phenoxy]acetamide |
| SMILES | CCCCCC(C)NC(=O)COc1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C16H21F3N2O4/c1-3-4-5-6-11(2)20-15(22)10-25-14-8-7-12(21(23)24)9-13(14)16(17,18)19/h7-9,11H,3-6,10H2,1-2H3,(H,20,22) |
| InChIKey | ZFCTXWLFXBLHAT-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|