C11H10F3N3O5 — CID 48923966
N-(methylcarbamoyl)-2-[4-nitro-2-(trifluoromethyl)phenoxy]acetamide (PubChem CID 48923966) has the molecular formula C11H10F3N3O5 and a molecular weight of 321.21 g/mol. Its IUPAC name is N-(methylcarbamoyl)-2-[4-nitro-2-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-(methylcarbamoyl)-2-[4-nitro-2-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 48923966 |
| Molecular Formula | C11H10F3N3O5 |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | N-(methylcarbamoyl)-2-[4-nitro-2-(trifluoromethyl)phenoxy]acetamide |
| SMILES | CNC(=O)NC(=O)COc1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C11H10F3N3O5/c1-15-10(19)16-9(18)5-22-8-3-2-6(17(20)21)4-7(8)11(12,13)14/h2-4H,5H2,1H3,(H2,15,16,18,19) |
| InChIKey | DMCNROCVLZNOME-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|