C11H9ClF3N3O5 — CID 40708016
2-(2-chloro-4-nitrophenoxy)-N-(2,2,2-trifluoroethylcarbamoyl)acetamide (PubChem CID 40708016) has the molecular formula C11H9ClF3N3O5 and a molecular weight of 355.66 g/mol. Its IUPAC name is 2-(2-chloro-4-nitrophenoxy)-N-(2,2,2-trifluoroethylcarbamoyl)acetamide.
| Compound Name | 2-(2-chloro-4-nitrophenoxy)-N-(2,2,2-trifluoroethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 40708016 |
| Molecular Formula | C11H9ClF3N3O5 |
| Molecular Weight | 355.66 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 2-(2-chloro-4-nitrophenoxy)-N-(2,2,2-trifluoroethylcarbamoyl)acetamide |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1Cl)NC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C11H9ClF3N3O5/c12-7-3-6(18(21)22)1-2-8(7)23-4-9(19)17-10(20)16-5-11(13,14)15/h1-3H,4-5H2,(H2,16,17,19,20) |
| InChIKey | BFFZAVYXQMPLHB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.66 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|