C12H10Br3N — CID 54392540
4-methyl-2-(2,2,2-tribromoethyl)quinoline (PubChem CID 54392540) has the molecular formula C12H10Br3N and a molecular weight of 407.93 g/mol. Its IUPAC name is 4-methyl-2-(2,2,2-tribromoethyl)quinoline.
| Compound Name | 4-methyl-2-(2,2,2-tribromoethyl)quinoline |
|---|---|
| PubChem CID | 54392540 |
| Molecular Formula | C12H10Br3N |
| Molecular Weight | 407.93 g/mol |
| Exact Mass | 404.84 |
| IUPAC Name | 4-methyl-2-(2,2,2-tribromoethyl)quinoline |
| SMILES | Cc1cc(CC(Br)(Br)Br)nc2ccccc12 |
| InChI | InChI=1S/C12H10Br3N/c1-8-6-9(7-12(13,14)15)16-11-5-3-2-4-10(8)11/h2-6H,7H2,1H3 |
| InChIKey | VHRHVZJMLMTBQN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.93 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|