C27H23N5O3 — CID 54393450
N-[1-(2-methoxyiminoethyl)-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-1H-indole-2-carboxamide (PubChem CID 54393450) has the molecular formula C27H23N5O3 and a molecular weight of 465.51 g/mol. Its IUPAC name is N-[1-(2-methoxyiminoethyl)-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-1H-indole-2-carboxamide.
| Compound Name | N-[1-(2-methoxyiminoethyl)-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 54393450 |
| Molecular Formula | C27H23N5O3 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | N-[1-(2-methoxyiminoethyl)-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-1H-indole-2-carboxamide |
| SMILES | CON=CCN1C(=O)C(NC(=O)c2cc3ccccc3[nH]2)N=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C27H23N5O3/c1-35-28-15-16-32-23-14-8-6-12-20(23)24(18-9-3-2-4-10-18)30-25(27(32)34)31-26(33)22-17-19-11-5-7-13-21(19)29-22/h2-15,17,25,29H,16H2,1H3,(H,31,33) |
| InChIKey | VIGUYESRZLDMRG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|