C29H24N4O4 — CID 67781030
methyl (Z)-4-[3-(1H-indole-2-carbonylamino)-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]but-2-enoate (PubChem CID 67781030) has the molecular formula C29H24N4O4 and a molecular weight of 492.54 g/mol. Its IUPAC name is methyl (Z)-4-[3-(1H-indole-2-carbonylamino)-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]but-2-enoate.
| Compound Name | methyl (Z)-4-[3-(1H-indole-2-carbonylamino)-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]but-2-enoate |
|---|---|
| PubChem CID | 67781030 |
| Molecular Formula | C29H24N4O4 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | methyl (Z)-4-[3-(1H-indole-2-carbonylamino)-2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl]but-2-enoate |
| SMILES | COC(=O)/C=C\CN1C(=O)C(NC(=O)c2cc3ccccc3[nH]2)N=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C29H24N4O4/c1-37-25(34)16-9-17-33-24-15-8-6-13-21(24)26(19-10-3-2-4-11-19)31-27(29(33)36)32-28(35)23-18-20-12-5-7-14-22(20)30-23/h2-16,18,27,30H,17H2,1H3,(H,32,35)/b16-9- |
| InChIKey | OPVKRKNTYFETEU-SXGWCWSVSA-N |
| XLogP | 3.84 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|