C14H14F17NO2S — CID 54395501
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-9-[(sulfinoamino)methyl]tridecane (PubChem CID 54395501) has the molecular formula C14H14F17NO2S and a molecular weight of 583.30 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-9-[(sulfinoamino)methyl]tridecane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-9-[(sulfinoamino)methyl]tridecane |
|---|---|
| PubChem CID | 54395501 |
| Molecular Formula | C14H14F17NO2S |
| Molecular Weight | 583.30 g/mol |
| Exact Mass | 583.05 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-9-[(sulfinoamino)methyl]tridecane |
| SMILES | CCCCC(CNS(=O)O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H14F17NO2S/c1-2-3-4-6(5-32-35(33)34)7(15,16)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)13(27,28)14(29,30)31/h6,32H,2-5H2,1H3,(H,33,34) |
| InChIKey | UHWOJAFTRWGZHU-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.30 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|