C10H23NO2S — CID 57421748
3,7-dimethyl-1-(sulfinoamino)octane (PubChem CID 57421748) has the molecular formula C10H23NO2S and a molecular weight of 221.37 g/mol. Its IUPAC name is 3,7-dimethyl-1-(sulfinoamino)octane.
| Compound Name | 3,7-dimethyl-1-(sulfinoamino)octane |
|---|---|
| PubChem CID | 57421748 |
| Molecular Formula | C10H23NO2S |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 3,7-dimethyl-1-(sulfinoamino)octane |
| SMILES | CC(C)CCCC(C)CCNS(=O)O |
| InChI | InChI=1S/C10H23NO2S/c1-9(2)5-4-6-10(3)7-8-11-14(12)13/h9-11H,4-8H2,1-3H3,(H,12,13) |
| InChIKey | KJSPRTRFNWVHCI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|