C29H40O5 — CID 54398967
3-(3-ethylphenyl)-2-propoxy-1-(2,3,4-tripropoxyphenyl)prop-2-en-1-one (PubChem CID 54398967) has the molecular formula C29H40O5 and a molecular weight of 468.63 g/mol. Its IUPAC name is 3-(3-ethylphenyl)-2-propoxy-1-(2,3,4-tripropoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-(3-ethylphenyl)-2-propoxy-1-(2,3,4-tripropoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 54398967 |
| Molecular Formula | C29H40O5 |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | 3-(3-ethylphenyl)-2-propoxy-1-(2,3,4-tripropoxyphenyl)prop-2-en-1-one |
| SMILES | CCCOC(=Cc1cccc(CC)c1)C(=O)c1ccc(OCCC)c(OCCC)c1OCCC |
| InChI | InChI=1S/C29H40O5/c1-6-16-31-25-15-14-24(28(33-18-8-3)29(25)34-19-9-4)27(30)26(32-17-7-2)21-23-13-11-12-22(10-5)20-23/h11-15,20-21H,6-10,16-19H2,1-5H3 |
| InChIKey | VMASOVAYENFORG-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|