C28H23ClN4O4S — CID 54401142
N-[[4-[2-(2-chloro-4-nitroanilino)-2-oxoethyl]phenyl]carbamothioyl]-5,6-dimethylnaphthalene-2-carboxamide (PubChem CID 54401142) has the molecular formula C28H23ClN4O4S and a molecular weight of 547.04 g/mol. Its IUPAC name is N-[[4-[2-(2-chloro-4-nitroanilino)-2-oxoethyl]phenyl]carbamothioyl]-5,6-dimethylnaphthalene-2-carboxamide.
| Compound Name | N-[[4-[2-(2-chloro-4-nitroanilino)-2-oxoethyl]phenyl]carbamothioyl]-5,6-dimethylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 54401142 |
| Molecular Formula | C28H23ClN4O4S |
| Molecular Weight | 547.04 g/mol |
| Exact Mass | 546.11 |
| IUPAC Name | N-[[4-[2-(2-chloro-4-nitroanilino)-2-oxoethyl]phenyl]carbamothioyl]-5,6-dimethylnaphthalene-2-carboxamide |
| SMILES | Cc1ccc2cc(C(=O)NC(=S)Nc3ccc(CC(=O)Nc4ccc([N+](=O)[O-])cc4Cl)cc3)ccc2c1C |
| InChI | InChI=1S/C28H23ClN4O4S/c1-16-3-6-19-14-20(7-11-23(19)17(16)2)27(35)32-28(38)30-21-8-4-18(5-9-21)13-26(34)31-25-12-10-22(33(36)37)15-24(25)29/h3-12,14-15H,13H2,1-2H3,(H,31,34)(H2,30,32,35,38) |
| InChIKey | WLYDYSWHQUWHMV-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.04 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|