About 1-iodotricyclo[5.2.1.02,6]dec-3-ene
1-iodotricyclo[5.2.1.02,6]dec-3-ene (PubChem CID 54402940) has the molecular formula C10H13I
and a molecular weight of 260.12 g/mol. Its IUPAC name is 1-iodotricyclo[5.2.1.02,6]dec-3-ene.
Molecular Properties
| Compound Name | 1-iodotricyclo[5.2.1.02,6]dec-3-ene |
| PubChem CID | 54402940 |
| Molecular Formula | C10H13I |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | 1-iodotricyclo[5.2.1.02,6]dec-3-ene |
| SMILES | IC12CCC(C1)C1CC=CC12 |
| InChI | InChI=1S/C10H13I/c11-10-5-4-7(6-10)8-2-1-3-9(8)10/h1,3,7-9H,2,4-6H2 |
| InChIKey | VOSKJSMCIPBEKU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-iodotricyclo[5.2.1.02,6]dec-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodotricyclo[5.2.1.02,6]dec-3-ene?
The IUPAC name of 1-iodotricyclo[5.2.1.02,6]dec-3-ene (CID 54402940) is 1-iodotricyclo[5.2.1.02,6]dec-3-ene.
What is the SMILES notation for 1-iodotricyclo[5.2.1.02,6]dec-3-ene?
The canonical SMILES for 1-iodotricyclo[5.2.1.02,6]dec-3-ene is IC12CCC(C1)C1CC=CC12.
What is the InChIKey of 1-iodotricyclo[5.2.1.02,6]dec-3-ene?
The InChIKey is VOSKJSMCIPBEKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13I/c11-10-5-4-7(6-10)8-2-1-3-9(8)10/h1,3,7-9H,2,4-6H2.
What are the key properties of 1-iodotricyclo[5.2.1.02,6]dec-3-ene?
1-iodotricyclo[5.2.1.02,6]dec-3-ene has a molecular weight of 260.12 g/mol, XLogP of 3.17, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodotricyclo[5.2.1.02,6]dec-3-ene is sourced from PubChem (CID 54402940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).