C14H23NO6 — CID 54405269
methyl 7-(2,5-dihydroxypyrrol-1-yl)-6,6-dimethoxyheptanoate (PubChem CID 54405269) has the molecular formula C14H23NO6 and a molecular weight of 301.34 g/mol. Its IUPAC name is methyl 7-(2,5-dihydroxypyrrol-1-yl)-6,6-dimethoxyheptanoate.
| Compound Name | methyl 7-(2,5-dihydroxypyrrol-1-yl)-6,6-dimethoxyheptanoate |
|---|---|
| PubChem CID | 54405269 |
| Molecular Formula | C14H23NO6 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | methyl 7-(2,5-dihydroxypyrrol-1-yl)-6,6-dimethoxyheptanoate |
| SMILES | COC(=O)CCCCC(Cn1c(O)ccc1O)(OC)OC |
| InChI | InChI=1S/C14H23NO6/c1-19-13(18)6-4-5-9-14(20-2,21-3)10-15-11(16)7-8-12(15)17/h7-8,16-17H,4-6,9-10H2,1-3H3 |
| InChIKey | VQGHXMFZPLIKFV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|