C20H25BrN5O+ — CID 54406609
[(2-bromoanilino)-(4-cyano-2-hydroxyanilino)methylidene]-[3-(dimethylamino)propyl]-methylazanium (PubChem CID 54406609) has the molecular formula C20H25BrN5O+ and a molecular weight of 431.36 g/mol. Its IUPAC name is [(2-bromoanilino)-(4-cyano-2-hydroxyanilino)methylidene]-[3-(dimethylamino)propyl]-methylazanium.
| Compound Name | [(2-bromoanilino)-(4-cyano-2-hydroxyanilino)methylidene]-[3-(dimethylamino)propyl]-methylazanium |
|---|---|
| PubChem CID | 54406609 |
| Molecular Formula | C20H25BrN5O+ |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | [(2-bromoanilino)-(4-cyano-2-hydroxyanilino)methylidene]-[3-(dimethylamino)propyl]-methylazanium |
| SMILES | CN(C)CCC/[N+](C)=C(/Nc1ccc(C#N)cc1O)Nc1ccccc1Br |
| InChI | InChI=1S/C20H24BrN5O/c1-25(2)11-6-12-26(3)20(23-17-8-5-4-7-16(17)21)24-18-10-9-15(14-22)13-19(18)27/h4-5,7-10,13H,6,11-12H2,1-3H3,(H2,23,24,27)/p+1 |
| InChIKey | YVDNIRAMXFKGLL-UHFFFAOYSA-O |
| XLogP | 3.50 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|