C17H14BrN3OS — CID 15549377
1-(2-bromophenyl)-3-(4-cyano-2-prop-2-enoxyphenyl)thiourea (PubChem CID 15549377) has the molecular formula C17H14BrN3OS and a molecular weight of 388.29 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3-(4-cyano-2-prop-2-enoxyphenyl)thiourea.
| Compound Name | 1-(2-bromophenyl)-3-(4-cyano-2-prop-2-enoxyphenyl)thiourea |
|---|---|
| PubChem CID | 15549377 |
| Molecular Formula | C17H14BrN3OS |
| Molecular Weight | 388.29 g/mol |
| Exact Mass | 387.00 |
| IUPAC Name | 1-(2-bromophenyl)-3-(4-cyano-2-prop-2-enoxyphenyl)thiourea |
| SMILES | C=CCOc1cc(C#N)ccc1NC(=S)Nc1ccccc1Br |
| InChI | InChI=1S/C17H14BrN3OS/c1-2-9-22-16-10-12(11-19)7-8-15(16)21-17(23)20-14-6-4-3-5-13(14)18/h2-8,10H,1,9H2,(H2,20,21,23) |
| InChIKey | AJQFTTSUCIWIDY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 57.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.29 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|